C30H28FNO6S — CID 170336695
5-[(2R,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-4-fluoro-1,2-thiazole-3-carboxylic acid (PubChem CID 170336695) has the molecular formula C30H28FNO6S and a molecular weight of 549.62 g/mol. Its IUPAC name is 5-[(2R,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-4-fluoro-1,2-thiazole-3-carboxylic acid.
| Compound Name | 5-[(2R,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-4-fluoro-1,2-thiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 170336695 |
| Molecular Formula | C30H28FNO6S |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | 5-[(2R,3R,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-4-fluoro-1,2-thiazole-3-carboxylic acid |
| SMILES | O=C(O)c1nsc([C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H]2OCc2ccccc2)c1F |
| InChI | InChI=1S/C30H28FNO6S/c31-24-25(30(33)34)32-39-29(24)28-27(37-18-22-14-8-3-9-15-22)26(36-17-21-12-6-2-7-13-21)23(38-28)19-35-16-20-10-4-1-5-11-20/h1-15,23,26-28H,16-19H2,(H,33,34)/t23-,26-,27-,28-/m1/s1 |
| InChIKey | RXIKNCBCIJIAMQ-NHMNHLDDSA-N |
| XLogP | 5.81 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |