C19H20ClN3O3 — CID 170336946
5-(1-chlorocyclopropyl)-7-oxospiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-2-carboxamide (PubChem CID 170336946) has the molecular formula C19H20ClN3O3 and a molecular weight of 373.84 g/mol. Its IUPAC name is 5-(1-chlorocyclopropyl)-7-oxospiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-2-carboxamide.
| Compound Name | 5-(1-chlorocyclopropyl)-7-oxospiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-2-carboxamide |
|---|---|
| PubChem CID | 170336946 |
| Molecular Formula | C19H20ClN3O3 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 5-(1-chlorocyclopropyl)-7-oxospiro[6,8-dihydrofuro[2,3-f]quinazoline-9,1'-cyclohexane]-2-carboxamide |
| SMILES | NC(=O)c1cc2cc(C3(Cl)CC3)c3c(c2o1)C1(CCCCC1)NC(=O)N3 |
| InChI | InChI=1S/C19H20ClN3O3/c20-18(6-7-18)11-8-10-9-12(16(21)24)26-15(10)13-14(11)22-17(25)23-19(13)4-2-1-3-5-19/h8-9H,1-7H2,(H2,21,24)(H2,22,23,25) |
| InChIKey | SXFQTCDFLVKTMA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|