C23H28N2O4 — CID 170337679
N-[1-(3,4-dimethoxyphenyl)ethyl]-2-[3-(prop-2-enoylamino)propyl]benzamide (PubChem CID 170337679) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[1-(3,4-dimethoxyphenyl)ethyl]-2-[3-(prop-2-enoylamino)propyl]benzamide.
| Compound Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-2-[3-(prop-2-enoylamino)propyl]benzamide |
|---|---|
| PubChem CID | 170337679 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-[1-(3,4-dimethoxyphenyl)ethyl]-2-[3-(prop-2-enoylamino)propyl]benzamide |
| SMILES | C=CC(=O)NCCCc1ccccc1C(=O)NC(C)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H28N2O4/c1-5-22(26)24-14-8-10-17-9-6-7-11-19(17)23(27)25-16(2)18-12-13-20(28-3)21(15-18)29-4/h5-7,9,11-13,15-16H,1,8,10,14H2,2-4H3,(H,24,26)(H,25,27) |
| InChIKey | NVFIAVSYCJSLDK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|