C24H27N3O7 — CID 170337744
(E)-4-[[2-[[2-[1-(3,4-dimethoxyphenyl)ethylcarbamoyl]phenyl]methylamino]-2-oxoethyl]amino]-4-oxobut-2-enoic acid (PubChem CID 170337744) has the molecular formula C24H27N3O7 and a molecular weight of 469.49 g/mol. Its IUPAC name is (E)-4-[[2-[[2-[1-(3,4-dimethoxyphenyl)ethylcarbamoyl]phenyl]methylamino]-2-oxoethyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[2-[[2-[1-(3,4-dimethoxyphenyl)ethylcarbamoyl]phenyl]methylamino]-2-oxoethyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 170337744 |
| Molecular Formula | C24H27N3O7 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | (E)-4-[[2-[[2-[1-(3,4-dimethoxyphenyl)ethylcarbamoyl]phenyl]methylamino]-2-oxoethyl]amino]-4-oxobut-2-enoic acid |
| SMILES | COc1ccc(C(C)NC(=O)c2ccccc2CNC(=O)CNC(=O)/C=C/C(=O)O)cc1OC |
| InChI | InChI=1S/C24H27N3O7/c1-15(16-8-9-19(33-2)20(12-16)34-3)27-24(32)18-7-5-4-6-17(18)13-25-22(29)14-26-21(28)10-11-23(30)31/h4-12,15H,13-14H2,1-3H3,(H,25,29)(H,26,28)(H,27,32)(H,30,31)/b11-10+ |
| InChIKey | GLIAWKALOZUKOB-ZHACJKMWSA-N |
| XLogP | 1.57 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|