C12H14FN5O4S — CID 170337946
5-[2-fluoro-6-hydroxy-4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 170337946) has the molecular formula C12H14FN5O4S and a molecular weight of 343.34 g/mol. Its IUPAC name is 5-[2-fluoro-6-hydroxy-4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[2-fluoro-6-hydroxy-4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 170337946 |
| Molecular Formula | C12H14FN5O4S |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 5-[2-fluoro-6-hydroxy-4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(c2c(O)cc(NC3=NCCCN3)cc2F)S(=O)(=O)N1 |
| InChI | InChI=1S/C12H14FN5O4S/c13-8-4-7(16-12-14-2-1-3-15-12)5-9(19)11(8)18-6-10(20)17-23(18,21)22/h4-5,19H,1-3,6H2,(H,17,20)(H2,14,15,16) |
| InChIKey | CLGLWNKKZLHKRV-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |