C13H16FN5O4S — CID 170337952
5-[2-fluoro-6-hydroxy-4-[(6-methyl-1,4,5,6-tetrahydropyrimidin-2-yl)amino]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one (PubChem CID 170337952) has the molecular formula C13H16FN5O4S and a molecular weight of 357.37 g/mol. Its IUPAC name is 5-[2-fluoro-6-hydroxy-4-[(6-methyl-1,4,5,6-tetrahydropyrimidin-2-yl)amino]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[2-fluoro-6-hydroxy-4-[(6-methyl-1,4,5,6-tetrahydropyrimidin-2-yl)amino]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 170337952 |
| Molecular Formula | C13H16FN5O4S |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 5-[2-fluoro-6-hydroxy-4-[(6-methyl-1,4,5,6-tetrahydropyrimidin-2-yl)amino]phenyl]-1,1-dioxo-1,2,5-thiadiazolidin-3-one |
| SMILES | CC1CCN=C(Nc2cc(O)c(N3CC(=O)NS3(=O)=O)c(F)c2)N1 |
| InChI | InChI=1S/C13H16FN5O4S/c1-7-2-3-15-13(16-7)17-8-4-9(14)12(10(20)5-8)19-6-11(21)18-24(19,22)23/h4-5,7,20H,2-3,6H2,1H3,(H,18,21)(H2,15,16,17) |
| InChIKey | ZQCMFHAFPWWDAP-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |