C16H19ClN2O3S2 — CID 17033950
N-(3-chloro-4-methoxyphenyl)-4-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)butanamide (PubChem CID 17033950) has the molecular formula C16H19ClN2O3S2 and a molecular weight of 386.93 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-4-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)butanamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-4-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)butanamide |
|---|---|
| PubChem CID | 17033950 |
| Molecular Formula | C16H19ClN2O3S2 |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-4-(5-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)butanamide |
| SMILES | CCC1SC(=S)N(CCCC(=O)Nc2ccc(OC)c(Cl)c2)C1=O |
| InChI | InChI=1S/C16H19ClN2O3S2/c1-3-13-15(21)19(16(23)24-13)8-4-5-14(20)18-10-6-7-12(22-2)11(17)9-10/h6-7,9,13H,3-5,8H2,1-2H3,(H,18,20) |
| InChIKey | SGPLMGAHNBQEBI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|