C19H17FI2N4O3S — CID 170342228
N-[4-[[3-(1-fluoro-1-iodoethyl)phenyl]sulfamoyl]-3-iodophenyl]-2-methylpyrazole-3-carboxamide (PubChem CID 170342228) has the molecular formula C19H17FI2N4O3S and a molecular weight of 654.24 g/mol. Its IUPAC name is N-[4-[[3-(1-fluoro-1-iodoethyl)phenyl]sulfamoyl]-3-iodophenyl]-2-methylpyrazole-3-carboxamide.
| Compound Name | N-[4-[[3-(1-fluoro-1-iodoethyl)phenyl]sulfamoyl]-3-iodophenyl]-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 170342228 |
| Molecular Formula | C19H17FI2N4O3S |
| Molecular Weight | 654.24 g/mol |
| Exact Mass | 653.91 |
| IUPAC Name | N-[4-[[3-(1-fluoro-1-iodoethyl)phenyl]sulfamoyl]-3-iodophenyl]-2-methylpyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)Nc1ccc(S(=O)(=O)Nc2cccc(C(C)(F)I)c2)c(I)c1 |
| InChI | InChI=1S/C19H17FI2N4O3S/c1-19(20,22)12-4-3-5-14(10-12)25-30(28,29)17-7-6-13(11-15(17)21)24-18(27)16-8-9-23-26(16)2/h3-11,25H,1-2H3,(H,24,27) |
| InChIKey | USHRWXVMVVGUFU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.24 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|