C20H24F2N4O3 — CID 170346788
5-amino-2-(4,4-difluorocyclohexyl)-6-[5-(methoxymethoxy)-2-methylphenyl]pyrimidine-4-carboxamide (PubChem CID 170346788) has the molecular formula C20H24F2N4O3 and a molecular weight of 406.43 g/mol. Its IUPAC name is 5-amino-2-(4,4-difluorocyclohexyl)-6-[5-(methoxymethoxy)-2-methylphenyl]pyrimidine-4-carboxamide.
| Compound Name | 5-amino-2-(4,4-difluorocyclohexyl)-6-[5-(methoxymethoxy)-2-methylphenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 170346788 |
| Molecular Formula | C20H24F2N4O3 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 5-amino-2-(4,4-difluorocyclohexyl)-6-[5-(methoxymethoxy)-2-methylphenyl]pyrimidine-4-carboxamide |
| SMILES | COCOc1ccc(C)c(-c2nc(C3CCC(F)(F)CC3)nc(C(N)=O)c2N)c1 |
| InChI | InChI=1S/C20H24F2N4O3/c1-11-3-4-13(29-10-28-2)9-14(11)16-15(23)17(18(24)27)26-19(25-16)12-5-7-20(21,22)8-6-12/h3-4,9,12H,5-8,10,23H2,1-2H3,(H2,24,27) |
| InChIKey | TXCLQJGQCQPTAQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 113.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|