C17H14FN5O2 — CID 177283593
5-amino-2-(6-fluoro-2-pyridinyl)-6-(5-hydroxy-2-methylphenyl)pyrimidine-4-carboxamide (PubChem CID 177283593) has the molecular formula C17H14FN5O2 and a molecular weight of 339.33 g/mol. Its IUPAC name is 5-amino-2-(6-fluoro-2-pyridinyl)-6-(5-hydroxy-2-methylphenyl)pyrimidine-4-carboxamide.
| Compound Name | 5-amino-2-(6-fluoro-2-pyridinyl)-6-(5-hydroxy-2-methylphenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 177283593 |
| Molecular Formula | C17H14FN5O2 |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 5-amino-2-(6-fluoro-2-pyridinyl)-6-(5-hydroxy-2-methylphenyl)pyrimidine-4-carboxamide |
| SMILES | Cc1ccc(O)cc1-c1nc(-c2cccc(F)n2)nc(C(N)=O)c1N |
| InChI | InChI=1S/C17H14FN5O2/c1-8-5-6-9(24)7-10(8)14-13(19)15(16(20)25)23-17(22-14)11-3-2-4-12(18)21-11/h2-7,24H,19H2,1H3,(H2,20,25) |
| InChIKey | MDSHNACHTFKALC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 128.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|