C18H12FN5O3 — CID 24937729
9-(3-fluorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purine-6-carboxamide (PubChem CID 24937729) has the molecular formula C18H12FN5O3 and a molecular weight of 365.32 g/mol. Its IUPAC name is 9-(3-fluorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purine-6-carboxamide.
| Compound Name | 9-(3-fluorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 24937729 |
| Molecular Formula | C18H12FN5O3 |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 9-(3-fluorophenyl)-2-(3-hydroxyphenyl)-8-oxo-7H-purine-6-carboxamide |
| SMILES | NC(=O)c1nc(-c2cccc(O)c2)nc2c1[nH]c(=O)n2-c1cccc(F)c1 |
| InChI | InChI=1S/C18H12FN5O3/c19-10-4-2-5-11(8-10)24-17-14(22-18(24)27)13(15(20)26)21-16(23-17)9-3-1-6-12(25)7-9/h1-8,25H,(H2,20,26)(H,22,27) |
| InChIKey | HMCPWRONXIQANG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |