C13H12N4O3 — CID 848601
8-(3-hydroxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 848601) has the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. Its IUPAC name is 8-(3-hydroxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-(3-hydroxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 848601 |
| Molecular Formula | C13H12N4O3 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 8-(3-hydroxyphenyl)-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(-c3cccc(O)c3)nc2n(C)c1=O |
| InChI | InChI=1S/C13H12N4O3/c1-16-11-9(12(19)17(2)13(16)20)14-10(15-11)7-4-3-5-8(18)6-7/h3-6,18H,1-2H3,(H,14,15) |
| InChIKey | UZPPSCQEEUUJSB-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |