C17H20N4O3 — CID 135433923
8-(4-hydroxyphenyl)-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 135433923) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 8-(4-hydroxyphenyl)-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-(4-hydroxyphenyl)-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 135433923 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 8-(4-hydroxyphenyl)-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3ccc(O)cc3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C17H20N4O3/c1-3-9-20-15-13(16(23)21(10-4-2)17(20)24)18-14(19-15)11-5-7-12(22)8-6-11/h5-8,22H,3-4,9-10H2,1-2H3,(H,18,19) |
| InChIKey | GLDYYZLOHBXJBU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |