C16H16N4O4 — CID 10404217
4-(1-butyl-2,6-dioxo-3,7-dihydropurin-8-yl)benzoic acid (PubChem CID 10404217) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is 4-(1-butyl-2,6-dioxo-3,7-dihydropurin-8-yl)benzoic acid.
| Compound Name | 4-(1-butyl-2,6-dioxo-3,7-dihydropurin-8-yl)benzoic acid |
|---|---|
| PubChem CID | 10404217 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 4-(1-butyl-2,6-dioxo-3,7-dihydropurin-8-yl)benzoic acid |
| SMILES | CCCCn1c(=O)[nH]c2nc(-c3ccc(C(=O)O)cc3)[nH]c2c1=O |
| InChI | InChI=1S/C16H16N4O4/c1-2-3-8-20-14(21)11-13(19-16(20)24)18-12(17-11)9-4-6-10(7-5-9)15(22)23/h4-7H,2-3,8H2,1H3,(H,17,18)(H,19,24)(H,22,23) |
| InChIKey | LMILITTYMRTXLT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |