C21H22FN3O3 — CID 170346848
tert-butyl-(3-tert-butyl-6-cyano-2-fluoro-[1]benzofuro[3,2-b]pyridin-7-yl)carbamic acid (PubChem CID 170346848) has the molecular formula C21H22FN3O3 and a molecular weight of 383.42 g/mol. Its IUPAC name is tert-butyl-(3-tert-butyl-6-cyano-2-fluoro-[1]benzofuro[3,2-b]pyridin-7-yl)carbamic acid.
| Compound Name | tert-butyl-(3-tert-butyl-6-cyano-2-fluoro-[1]benzofuro[3,2-b]pyridin-7-yl)carbamic acid |
|---|---|
| PubChem CID | 170346848 |
| Molecular Formula | C21H22FN3O3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | tert-butyl-(3-tert-butyl-6-cyano-2-fluoro-[1]benzofuro[3,2-b]pyridin-7-yl)carbamic acid |
| SMILES | CC(C)(C)c1cc2oc3c(C#N)c(N(C(=O)O)C(C)(C)C)ccc3c2nc1F |
| InChI | InChI=1S/C21H22FN3O3/c1-20(2,3)13-9-15-16(24-18(13)22)11-7-8-14(12(10-23)17(11)28-15)25(19(26)27)21(4,5)6/h7-9H,1-6H3,(H,26,27) |
| InChIKey | ODKWDIWGHITNJD-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|