C11H13BrFNO2 — CID 66589257
(4-bromo-2-fluorophenyl)-tert-butylcarbamic acid (PubChem CID 66589257) has the molecular formula C11H13BrFNO2 and a molecular weight of 290.13 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl)-tert-butylcarbamic acid.
| Compound Name | (4-bromo-2-fluorophenyl)-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 66589257 |
| Molecular Formula | C11H13BrFNO2 |
| Molecular Weight | 290.13 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | (4-bromo-2-fluorophenyl)-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C11H13BrFNO2/c1-11(2,3)14(10(15)16)9-5-4-7(12)6-8(9)13/h4-6H,1-3H3,(H,15,16) |
| InChIKey | APSOTCXXFBYRHT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.13 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |