C25H25FN4O5S — CID 170347881
4-amino-N-[2-[(6-fluoro-19-hydroxy-7-methyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-8-yl)sulfanyl]ethyl]butanamide (PubChem CID 170347881) has the molecular formula C25H25FN4O5S and a molecular weight of 512.56 g/mol. Its IUPAC name is 4-amino-N-[2-[(6-fluoro-19-hydroxy-7-methyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-8-yl)sulfanyl]ethyl]butanamide.
| Compound Name | 4-amino-N-[2-[(6-fluoro-19-hydroxy-7-methyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-8-yl)sulfanyl]ethyl]butanamide |
|---|---|
| PubChem CID | 170347881 |
| Molecular Formula | C25H25FN4O5S |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 4-amino-N-[2-[(6-fluoro-19-hydroxy-7-methyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaen-8-yl)sulfanyl]ethyl]butanamide |
| SMILES | Cc1c(F)cc2nc3c(cc2c1SCCNC(=O)CCCN)Cn1c-3cc2c(c1=O)COC(=O)C2O |
| InChI | InChI=1S/C25H25FN4O5S/c1-12-17(26)9-18-15(23(12)36-6-5-28-20(31)3-2-4-27)7-13-10-30-19(21(13)29-18)8-14-16(24(30)33)11-35-25(34)22(14)32/h7-9,22,32H,2-6,10-11,27H2,1H3,(H,28,31) |
| InChIKey | FJBOZRTZQGTLLZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|