C23H16FN3O7 — CID 178153645
2-formylprop-2-enyl N-(6-fluoro-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl)carbamate (PubChem CID 178153645) has the molecular formula C23H16FN3O7 and a molecular weight of 465.39 g/mol. Its IUPAC name is 2-formylprop-2-enyl N-(6-fluoro-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl)carbamate.
| Compound Name | 2-formylprop-2-enyl N-(6-fluoro-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl)carbamate |
|---|---|
| PubChem CID | 178153645 |
| Molecular Formula | C23H16FN3O7 |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 2-formylprop-2-enyl N-(6-fluoro-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl)carbamate |
| SMILES | C=C(C=O)COC(=O)Nc1cc2cc3c(nc2cc1F)-c1cc2c(c(=O)n1C3)COC(=O)C2O |
| InChI | InChI=1S/C23H16FN3O7/c1-10(7-28)8-34-23(32)26-17-3-11-2-12-6-27-18(19(12)25-16(11)5-15(17)24)4-13-14(21(27)30)9-33-22(31)20(13)29/h2-5,7,20,29H,1,6,8-9H2,(H,26,32) |
| InChIKey | XCXXRVYEVYPYLW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|