C26H22FN3O8 — CID 178152917
3-[[(19S)-19-ethyl-6-fluoro-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl]carbamoyloxy]-2-methylidenebutanoic acid (PubChem CID 178152917) has the molecular formula C26H22FN3O8 and a molecular weight of 523.47 g/mol. Its IUPAC name is 3-[[(19S)-19-ethyl-6-fluoro-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl]carbamoyloxy]-2-methylidenebutanoic acid.
| Compound Name | 3-[[(19S)-19-ethyl-6-fluoro-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl]carbamoyloxy]-2-methylidenebutanoic acid |
|---|---|
| PubChem CID | 178152917 |
| Molecular Formula | C26H22FN3O8 |
| Molecular Weight | 523.47 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 3-[[(19S)-19-ethyl-6-fluoro-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl]carbamoyloxy]-2-methylidenebutanoic acid |
| SMILES | C=C(C(=O)O)C(C)OC(=O)Nc1cc2cc3c(nc2cc1F)-c1cc2c(c(=O)n1C3)COC(=O)[C@]2(O)CC |
| InChI | InChI=1S/C26H22FN3O8/c1-4-26(36)16-7-20-21-14(9-30(20)22(31)15(16)10-37-24(26)34)5-13-6-19(17(27)8-18(13)28-21)29-25(35)38-12(3)11(2)23(32)33/h5-8,12,36H,2,4,9-10H2,1,3H3,(H,29,35)(H,32,33)/t12?,26-/m0/s1 |
| InChIKey | NYHOPBLUCQCWQX-IOEOUFTISA-N |
| XLogP | 2.80 |
| TPSA | 157.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|