C22H30ClN5O3 — CID 170351522
tert-butyl 3-[6-chloro-1-(oxan-2-yl)pyrazolo[4,3-c]pyridin-3-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 170351522) has the molecular formula C22H30ClN5O3 and a molecular weight of 447.97 g/mol. Its IUPAC name is tert-butyl 3-[6-chloro-1-(oxan-2-yl)pyrazolo[4,3-c]pyridin-3-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 3-[6-chloro-1-(oxan-2-yl)pyrazolo[4,3-c]pyridin-3-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 170351522 |
| Molecular Formula | C22H30ClN5O3 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | tert-butyl 3-[6-chloro-1-(oxan-2-yl)pyrazolo[4,3-c]pyridin-3-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CN(c1nn(C3CCCCO3)c3cc(Cl)ncc13)C2 |
| InChI | InChI=1S/C22H30ClN5O3/c1-22(2,3)31-21(29)27-14-7-8-15(27)13-26(12-14)20-16-11-24-18(23)10-17(16)28(25-20)19-6-4-5-9-30-19/h10-11,14-15,19H,4-9,12-13H2,1-3H3 |
| InChIKey | FWALTKMELGEXIP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|