C21H30ClN5O3 — CID 177282312
tert-butyl N-[(3S,4S)-1-[6-chloro-1-(oxan-2-yl)pyrazolo[4,3-c]pyridin-3-yl]-4-methylpyrrolidin-3-yl]carbamate (PubChem CID 177282312) has the molecular formula C21H30ClN5O3 and a molecular weight of 435.96 g/mol. Its IUPAC name is tert-butyl N-[(3S,4S)-1-[6-chloro-1-(oxan-2-yl)pyrazolo[4,3-c]pyridin-3-yl]-4-methylpyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4S)-1-[6-chloro-1-(oxan-2-yl)pyrazolo[4,3-c]pyridin-3-yl]-4-methylpyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 177282312 |
| Molecular Formula | C21H30ClN5O3 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | tert-butyl N-[(3S,4S)-1-[6-chloro-1-(oxan-2-yl)pyrazolo[4,3-c]pyridin-3-yl]-4-methylpyrrolidin-3-yl]carbamate |
| SMILES | C[C@H]1CN(c2nn(C3CCCCO3)c3cc(Cl)ncc23)C[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H30ClN5O3/c1-13-11-26(12-15(13)24-20(28)30-21(2,3)4)19-14-10-23-17(22)9-16(14)27(25-19)18-7-5-6-8-29-18/h9-10,13,15,18H,5-8,11-12H2,1-4H3,(H,24,28)/t13-,15+,18?/m0/s1 |
| InChIKey | ANRQBNANRWHPOF-POXCNRTASA-N |
| XLogP | 4.13 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|