C18H14FN5 — CID 170351905
5-(2-amino-4-pyridinyl)-7-(3-fluorophenyl)-1H-indazol-3-amine (PubChem CID 170351905) has the molecular formula C18H14FN5 and a molecular weight of 319.34 g/mol. Its IUPAC name is 5-(2-amino-4-pyridinyl)-7-(3-fluorophenyl)-1H-indazol-3-amine.
| Compound Name | 5-(2-amino-4-pyridinyl)-7-(3-fluorophenyl)-1H-indazol-3-amine |
|---|---|
| PubChem CID | 170351905 |
| Molecular Formula | C18H14FN5 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 5-(2-amino-4-pyridinyl)-7-(3-fluorophenyl)-1H-indazol-3-amine |
| SMILES | Nc1cc(-c2cc(-c3cccc(F)c3)c3[nH]nc(N)c3c2)ccn1 |
| InChI | InChI=1S/C18H14FN5/c19-13-3-1-2-11(6-13)14-7-12(10-4-5-22-16(20)9-10)8-15-17(14)23-24-18(15)21/h1-9H,(H2,20,22)(H3,21,23,24) |
| InChIKey | WWIFCISBUWDWDS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |