C18H12FN3O — CID 71679952
7-(3-fluorophenyl)-4-(1,3-oxazol-2-yl)isoquinolin-1-amine (PubChem CID 71679952) has the molecular formula C18H12FN3O and a molecular weight of 305.31 g/mol. Its IUPAC name is 7-(3-fluorophenyl)-4-(1,3-oxazol-2-yl)isoquinolin-1-amine.
| Compound Name | 7-(3-fluorophenyl)-4-(1,3-oxazol-2-yl)isoquinolin-1-amine |
|---|---|
| PubChem CID | 71679952 |
| Molecular Formula | C18H12FN3O |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 7-(3-fluorophenyl)-4-(1,3-oxazol-2-yl)isoquinolin-1-amine |
| SMILES | Nc1ncc(-c2ncco2)c2ccc(-c3cccc(F)c3)cc12 |
| InChI | InChI=1S/C18H12FN3O/c19-13-3-1-2-11(8-13)12-4-5-14-15(9-12)17(20)22-10-16(14)18-21-6-7-23-18/h1-10H,(H2,20,22) |
| InChIKey | VXMYHZDCXLNMFO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |