C13H7F2N3O — CID 25009809
2-(3-fluorophenyl)-5-(6-fluoro-3-pyridinyl)-1,3,4-oxadiazole (PubChem CID 25009809) has the molecular formula C13H7F2N3O and a molecular weight of 259.22 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-5-(6-fluoro-3-pyridinyl)-1,3,4-oxadiazole.
| Compound Name | 2-(3-fluorophenyl)-5-(6-fluoro-3-pyridinyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 25009809 |
| Molecular Formula | C13H7F2N3O |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-(3-fluorophenyl)-5-(6-fluoro-3-pyridinyl)-1,3,4-oxadiazole |
| SMILES | Fc1cccc(-c2nnc(-c3ccc(F)nc3)o2)c1 |
| InChI | InChI=1S/C13H7F2N3O/c14-10-3-1-2-8(6-10)12-17-18-13(19-12)9-4-5-11(15)16-7-9/h1-7H |
| InChIKey | FDLKCPPLEJXFSF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|