C11H11FN2O2 — CID 82127841
3-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]propan-1-ol (PubChem CID 82127841) has the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. Its IUPAC name is 3-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]propan-1-ol.
| Compound Name | 3-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 82127841 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 3-[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]propan-1-ol |
| SMILES | OCCCc1nnc(-c2cccc(F)c2)o1 |
| InChI | InChI=1S/C11H11FN2O2/c12-9-4-1-3-8(7-9)11-14-13-10(16-11)5-2-6-15/h1,3-4,7,15H,2,5-6H2 |
| InChIKey | YTBVRXDKEQVETI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |