C14H17FN2O2S — CID 71926171
2-(3-fluorophenyl)-5-(2-propan-2-yloxyethylsulfanylmethyl)-1,3,4-oxadiazole (PubChem CID 71926171) has the molecular formula C14H17FN2O2S and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-5-(2-propan-2-yloxyethylsulfanylmethyl)-1,3,4-oxadiazole.
| Compound Name | 2-(3-fluorophenyl)-5-(2-propan-2-yloxyethylsulfanylmethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 71926171 |
| Molecular Formula | C14H17FN2O2S |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-(3-fluorophenyl)-5-(2-propan-2-yloxyethylsulfanylmethyl)-1,3,4-oxadiazole |
| SMILES | CC(C)OCCSCc1nnc(-c2cccc(F)c2)o1 |
| InChI | InChI=1S/C14H17FN2O2S/c1-10(2)18-6-7-20-9-13-16-17-14(19-13)11-4-3-5-12(15)8-11/h3-5,8,10H,6-7,9H2,1-2H3 |
| InChIKey | YRRPRHUUAJNXOZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|