C20H17FN6O3 — CID 163806299
3-[[[[1-amino-7-(3-fluorophenyl)isoquinolin-4-yl]-hydroxymethyl]amino]methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 163806299) has the molecular formula C20H17FN6O3 and a molecular weight of 408.39 g/mol. Its IUPAC name is 3-[[[[1-amino-7-(3-fluorophenyl)isoquinolin-4-yl]-hydroxymethyl]amino]methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[[[[1-amino-7-(3-fluorophenyl)isoquinolin-4-yl]-hydroxymethyl]amino]methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 163806299 |
| Molecular Formula | C20H17FN6O3 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 3-[[[[1-amino-7-(3-fluorophenyl)isoquinolin-4-yl]-hydroxymethyl]amino]methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | NC(=O)c1nc(CNC(O)c2cnc(N)c3cc(-c4cccc(F)c4)ccc23)no1 |
| InChI | InChI=1S/C20H17FN6O3/c21-12-3-1-2-10(6-12)11-4-5-13-14(7-11)17(22)24-8-15(13)19(29)25-9-16-26-20(18(23)28)30-27-16/h1-8,19,25,29H,9H2,(H2,22,24)(H2,23,28) |
| InChIKey | NJIDZESSQSYECQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 153.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|