C9H5F2NO — CID 10678958
2-(2,5-difluorophenyl)-1,3-oxazole (PubChem CID 10678958) has the molecular formula C9H5F2NO and a molecular weight of 181.14 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-1,3-oxazole.
| Compound Name | 2-(2,5-difluorophenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 10678958 |
| Molecular Formula | C9H5F2NO |
| Molecular Weight | 181.14 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 2-(2,5-difluorophenyl)-1,3-oxazole |
| SMILES | Fc1ccc(F)c(-c2ncco2)c1 |
| InChI | InChI=1S/C9H5F2NO/c10-6-1-2-8(11)7(5-6)9-12-3-4-13-9/h1-5H |
| InChIKey | CGVQLZGPVMIAHM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.14 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |