C9H5FIrNO- — CID 21032976
2-(4-fluorobenzene-6-id-1-yl)-1,3-oxazole;iridium (PubChem CID 21032976) has the molecular formula C9H5FIrNO- and a molecular weight of 354.36 g/mol. Its IUPAC name is 2-(4-fluorobenzene-6-id-1-yl)-1,3-oxazole;iridium.
| Compound Name | 2-(4-fluorobenzene-6-id-1-yl)-1,3-oxazole;iridium |
|---|---|
| PubChem CID | 21032976 |
| Molecular Formula | C9H5FIrNO- |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | 2-(4-fluorobenzene-6-id-1-yl)-1,3-oxazole;iridium |
| SMILES | Fc1c[c-]c(-c2ncco2)cc1.[Ir] |
| InChI | InChI=1S/C9H5FNO.Ir/c10-8-3-1-7(2-4-8)9-11-5-6-12-9;/h1,3-6H;/q-1; |
| InChIKey | SVBHPTPNGMVXDR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|