C20H12F2IrN3O3- — CID 91866468
2-(4-fluorobenzene-6-id-1-yl)-5-(4-fluorophenyl)-1,3,4-oxadiazole;iridium;pyridine-2-carboxylic acid (PubChem CID 91866468) has the molecular formula C20H12F2IrN3O3- and a molecular weight of 572.55 g/mol. Its IUPAC name is 2-(4-fluorobenzene-6-id-1-yl)-5-(4-fluorophenyl)-1,3,4-oxadiazole;iridium;pyridine-2-carboxylic acid.
| Compound Name | 2-(4-fluorobenzene-6-id-1-yl)-5-(4-fluorophenyl)-1,3,4-oxadiazole;iridium;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 91866468 |
| Molecular Formula | C20H12F2IrN3O3- |
| Molecular Weight | 572.55 g/mol |
| Exact Mass | 573.05 |
| IUPAC Name | 2-(4-fluorobenzene-6-id-1-yl)-5-(4-fluorophenyl)-1,3,4-oxadiazole;iridium;pyridine-2-carboxylic acid |
| SMILES | Fc1c[c-]c(-c2nnc(-c3ccc(F)cc3)o2)cc1.O=C(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C14H7F2N2O.C6H5NO2.Ir/c15-11-5-1-9(2-6-11)13-17-18-14(19-13)10-3-7-12(16)8-4-10;8-6(9)5-3-1-2-4-7-5;/h1-3,5-8H;1-4H,(H,8,9);/q-1;; |
| InChIKey | YRGSRDCTGTVYSY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|