About 2-(4-fluorobenzene-6-id-1-yl)pyridine;iridium;methyl-(2-methylphosphanylphenyl)phosphane
2-(4-fluorobenzene-6-id-1-yl)pyridine;iridium;methyl-(2-methylphosphanylphenyl)phosphane (PubChem CID 23531572) has the molecular formula C19H19FIrNP2-
and a molecular weight of 534.53 g/mol. Its IUPAC name is 2-(4-fluorobenzene-6-id-1-yl)pyridine;iridium;methyl-(2-methylphosphanylphenyl)phosphane.
Molecular Properties
| Compound Name | 2-(4-fluorobenzene-6-id-1-yl)pyridine;iridium;methyl-(2-methylphosphanylphenyl)phosphane |
| PubChem CID | 23531572 |
| Molecular Formula | C19H19FIrNP2- |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | 2-(4-fluorobenzene-6-id-1-yl)pyridine;iridium;methyl-(2-methylphosphanylphenyl)phosphane |
| SMILES | CPc1ccccc1PC.Fc1c[c-]c(-c2ccccn2)cc1.[Ir] |
| InChI | InChI=1S/C11H7FN.C8H12P2.Ir/c12-10-6-4-9(5-7-10)11-3-1-2-8-13-11;1-9-7-5-3-4-6-8(7)10-2;/h1-4,6-8H;3-6,9-10H,1-2H3;/q-1;; |
| InChIKey | GNRVZHYZTUDKDR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-fluorobenzene-6-id-1-yl)pyridine;iridium;methyl-(2-methylphosphanylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorobenzene-6-id-1-yl)pyridine;iridium;methyl-(2-methylphosphanylphenyl)phosphane?
The IUPAC name of 2-(4-fluorobenzene-6-id-1-yl)pyridine;iridium;methyl-(2-methylphosphanylphenyl)phosphane (CID 23531572) is 2-(4-fluorobenzene-6-id-1-yl)pyridine;iridium;methyl-(2-methylphosphanylphenyl)phosphane.
What is the SMILES notation for 2-(4-fluorobenzene-6-id-1-yl)pyridine;iridium;methyl-(2-methylphosphanylphenyl)phosphane?
The canonical SMILES for 2-(4-fluorobenzene-6-id-1-yl)pyridine;iridium;methyl-(2-methylphosphanylphenyl)phosphane is CPc1ccccc1PC.Fc1c[c-]c(-c2ccccn2)cc1.[Ir].
What is the InChIKey of 2-(4-fluorobenzene-6-id-1-yl)pyridine;iridium;methyl-(2-methylphosphanylphenyl)phosphane?
The InChIKey is GNRVZHYZTUDKDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7FN.C8H12P2.Ir/c12-10-6-4-9(5-7-10)11-3-1-2-8-13-11;1-9-7-5-3-4-6-8(7)10-2;/h1-4,6-8H;3-6,9-10H,1-2H3;/q-1;;.
What are the key properties of 2-(4-fluorobenzene-6-id-1-yl)pyridine;iridium;methyl-(2-methylphosphanylphenyl)phosphane?
2-(4-fluorobenzene-6-id-1-yl)pyridine;iridium;methyl-(2-methylphosphanylphenyl)phosphane has a molecular weight of 534.53 g/mol, XLogP of 4.24, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorobenzene-6-id-1-yl)pyridine;iridium;methyl-(2-methylphosphanylphenyl)phosphane is sourced from PubChem (CID 23531572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).