C31H16FIrN3O-2 — CID 176753067
CID 176753067 (PubChem CID 176753067) has the molecular formula C31H16FIrN3O-2 and a molecular weight of 657.70 g/mol.
| Compound Name | CID 176753067 |
|---|---|
| PubChem CID | 176753067 |
| Molecular Formula | C31H16FIrN3O-2 |
| Molecular Weight | 657.70 g/mol |
| Exact Mass | 658.09 |
| IUPAC Name | — |
| SMILES | Fc1c[c-]c(-c2ccccn2)cc1.[C-]#[N+]c1cccc2oc3c4ccc[c-]c4c4ncccc4c3c12.[Ir] |
| InChI | InChI=1S/C20H9N2O.C11H7FN.Ir/c1-21-15-9-4-10-16-18(15)17-14-8-5-11-22-19(14)12-6-2-3-7-13(12)20(17)23-16;12-10-6-4-9(5-7-10)11-3-1-2-8-13-11;/h2-5,7-11H;1-4,6-8H;/q2*-1; |
| InChIKey | JHJNUPAFMYVMTM-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 43.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.70 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|