C9H12F2N2O — CID 170351964
2-(1,1-difluoroethyl)-4-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 170351964) has the molecular formula C9H12F2N2O and a molecular weight of 202.20 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-4-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 2-(1,1-difluoroethyl)-4-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 170351964 |
| Molecular Formula | C9H12F2N2O |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 2-(1,1-difluoroethyl)-4-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CC(C)c1cc(=O)[nH]c(C(C)(F)F)n1 |
| InChI | InChI=1S/C9H12F2N2O/c1-5(2)6-4-7(14)13-8(12-6)9(3,10)11/h4-5H,1-3H3,(H,12,13,14) |
| InChIKey | GRWMEEFDYGFESI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |