C20H25N5O — CID 170352169
1-[2-[2-amino-4-(3-amino-1H-indazol-5-yl)-3-pyridinyl]ethyl]cyclohexan-1-ol (PubChem CID 170352169) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-[2-[2-amino-4-(3-amino-1H-indazol-5-yl)-3-pyridinyl]ethyl]cyclohexan-1-ol.
| Compound Name | 1-[2-[2-amino-4-(3-amino-1H-indazol-5-yl)-3-pyridinyl]ethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 170352169 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 1-[2-[2-amino-4-(3-amino-1H-indazol-5-yl)-3-pyridinyl]ethyl]cyclohexan-1-ol |
| SMILES | Nc1nccc(-c2ccc3[nH]nc(N)c3c2)c1CCC1(O)CCCCC1 |
| InChI | InChI=1S/C20H25N5O/c21-18-15(6-10-20(26)8-2-1-3-9-20)14(7-11-23-18)13-4-5-17-16(12-13)19(22)25-24-17/h4-5,7,11-12,26H,1-3,6,8-10H2,(H2,21,23)(H3,22,24,25) |
| InChIKey | OEEPNTXILVQMDG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |