C29H35F3N4O7 — CID 170354111
[2-[3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]propanoyl-[2-(methylamino)ethyl]amino]ethyl-methylcarbamoyl] 2,2,2-trifluoroacetate (PubChem CID 170354111) has the molecular formula C29H35F3N4O7 and a molecular weight of 608.61 g/mol. Its IUPAC name is [2-[3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]propanoyl-[2-(methylamino)ethyl]amino]ethyl-methylcarbamoyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]propanoyl-[2-(methylamino)ethyl]amino]ethyl-methylcarbamoyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 170354111 |
| Molecular Formula | C29H35F3N4O7 |
| Molecular Weight | 608.61 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | [2-[3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]propanoyl-[2-(methylamino)ethyl]amino]ethyl-methylcarbamoyl] 2,2,2-trifluoroacetate |
| SMILES | CNCCN(CCN(C)C(=O)OC(=O)C(F)(F)F)C(=O)CCOCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C29H35F3N4O7/c1-33-12-14-36(16-15-35(2)28(40)43-26(38)29(30,31)32)25(37)11-17-41-18-13-34-27(39)42-19-24-22-9-5-3-7-20(22)21-8-4-6-10-23(21)24/h3-10,24,33H,11-19H2,1-2H3,(H,34,39) |
| InChIKey | PCDFMTFEYUKPLH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.61 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|