C20H14F3N5O3 — CID 170355117
2-[4-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazole-3-carbonyl]piperazin-1-yl]benzonitrile (PubChem CID 170355117) has the molecular formula C20H14F3N5O3 and a molecular weight of 429.36 g/mol. Its IUPAC name is 2-[4-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazole-3-carbonyl]piperazin-1-yl]benzonitrile.
| Compound Name | 2-[4-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazole-3-carbonyl]piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 170355117 |
| Molecular Formula | C20H14F3N5O3 |
| Molecular Weight | 429.36 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 2-[4-[5-(2,4,5-trifluoro-3-hydroxyphenyl)-1,2,4-oxadiazole-3-carbonyl]piperazin-1-yl]benzonitrile |
| SMILES | N#Cc1ccccc1N1CCN(C(=O)c2noc(-c3cc(F)c(F)c(O)c3F)n2)CC1 |
| InChI | InChI=1S/C20H14F3N5O3/c21-13-9-12(15(22)17(29)16(13)23)19-25-18(26-31-19)20(30)28-7-5-27(6-8-28)14-4-2-1-3-11(14)10-24/h1-4,9,29H,5-8H2 |
| InChIKey | BPGGBZVPHUTIBI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|