C18H28N2O3 — CID 170356926
[2-(methylamino)-3-phenylmethoxypropyl] 1-ethylpyrrolidine-2-carboxylate (PubChem CID 170356926) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is [2-(methylamino)-3-phenylmethoxypropyl] 1-ethylpyrrolidine-2-carboxylate.
| Compound Name | [2-(methylamino)-3-phenylmethoxypropyl] 1-ethylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 170356926 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | [2-(methylamino)-3-phenylmethoxypropyl] 1-ethylpyrrolidine-2-carboxylate |
| SMILES | CCN1CCCC1C(=O)OCC(COCc1ccccc1)NC |
| InChI | InChI=1S/C18H28N2O3/c1-3-20-11-7-10-17(20)18(21)23-14-16(19-2)13-22-12-15-8-5-4-6-9-15/h4-6,8-9,16-17,19H,3,7,10-14H2,1-2H3 |
| InChIKey | HKGONAIKORBUJL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |