C21H21Cl2N3O2 — CID 170358830
5-chloro-4-[1-[(3-chlorophenyl)methyl]piperidin-4-yl]-1-methylquinoxaline-2,3-dione (PubChem CID 170358830) has the molecular formula C21H21Cl2N3O2 and a molecular weight of 418.32 g/mol. Its IUPAC name is 5-chloro-4-[1-[(3-chlorophenyl)methyl]piperidin-4-yl]-1-methylquinoxaline-2,3-dione.
| Compound Name | 5-chloro-4-[1-[(3-chlorophenyl)methyl]piperidin-4-yl]-1-methylquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 170358830 |
| Molecular Formula | C21H21Cl2N3O2 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 5-chloro-4-[1-[(3-chlorophenyl)methyl]piperidin-4-yl]-1-methylquinoxaline-2,3-dione |
| SMILES | Cn1c(=O)c(=O)n(C2CCN(Cc3cccc(Cl)c3)CC2)c2c(Cl)cccc21 |
| InChI | InChI=1S/C21H21Cl2N3O2/c1-24-18-7-3-6-17(23)19(18)26(21(28)20(24)27)16-8-10-25(11-9-16)13-14-4-2-5-15(22)12-14/h2-7,12,16H,8-11,13H2,1H3 |
| InChIKey | BDRYEMKXWDOJQU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|