C25H36ClN3O2 — CID 170359044
2-[4-[2-[(4-chlorophenyl)methyl]-4-(2-ethoxyethyl)piperazin-1-yl]cyclohexyl]-5-methyl-1,3-oxazole (PubChem CID 170359044) has the molecular formula C25H36ClN3O2 and a molecular weight of 446.04 g/mol. Its IUPAC name is 2-[4-[2-[(4-chlorophenyl)methyl]-4-(2-ethoxyethyl)piperazin-1-yl]cyclohexyl]-5-methyl-1,3-oxazole.
| Compound Name | 2-[4-[2-[(4-chlorophenyl)methyl]-4-(2-ethoxyethyl)piperazin-1-yl]cyclohexyl]-5-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 170359044 |
| Molecular Formula | C25H36ClN3O2 |
| Molecular Weight | 446.04 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 2-[4-[2-[(4-chlorophenyl)methyl]-4-(2-ethoxyethyl)piperazin-1-yl]cyclohexyl]-5-methyl-1,3-oxazole |
| SMILES | CCOCCN1CCN(C2CCC(c3ncc(C)o3)CC2)C(Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C25H36ClN3O2/c1-3-30-15-14-28-12-13-29(24(18-28)16-20-4-8-22(26)9-5-20)23-10-6-21(7-11-23)25-27-17-19(2)31-25/h4-5,8-9,17,21,23-24H,3,6-7,10-16,18H2,1-2H3 |
| InChIKey | NZDFBPFDAXJZFS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.04 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|