C27H28IO6P — CID 170359896
iodo 2-methoxy-5-[4-methyl-4-(naphthalen-1-ylmethoxycarbonyl)cyclohexyl]oxy-4-phosphanylbenzoate (PubChem CID 170359896) has the molecular formula C27H28IO6P and a molecular weight of 606.39 g/mol. Its IUPAC name is iodo 2-methoxy-5-[4-methyl-4-(naphthalen-1-ylmethoxycarbonyl)cyclohexyl]oxy-4-phosphanylbenzoate.
| Compound Name | iodo 2-methoxy-5-[4-methyl-4-(naphthalen-1-ylmethoxycarbonyl)cyclohexyl]oxy-4-phosphanylbenzoate |
|---|---|
| PubChem CID | 170359896 |
| Molecular Formula | C27H28IO6P |
| Molecular Weight | 606.39 g/mol |
| Exact Mass | 606.07 |
| IUPAC Name | iodo 2-methoxy-5-[4-methyl-4-(naphthalen-1-ylmethoxycarbonyl)cyclohexyl]oxy-4-phosphanylbenzoate |
| SMILES | COc1cc(P)c(OC2CCC(C)(C(=O)OCc3cccc4ccccc34)CC2)cc1C(=O)OI |
| InChI | InChI=1S/C27H28IO6P/c1-27(26(30)32-16-18-8-5-7-17-6-3-4-9-20(17)18)12-10-19(11-13-27)33-23-14-21(25(29)34-28)22(31-2)15-24(23)35/h3-9,14-15,19H,10-13,16,35H2,1-2H3 |
| InChIKey | OPNREZRRHFJGOY-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.39 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|