C18H24ClNO3 — CID 170360914
1-[2-[3-(4-chlorophenyl)-2-methylpropoxy]butyl]pyrrolidine-2,5-dione (PubChem CID 170360914) has the molecular formula C18H24ClNO3 and a molecular weight of 337.85 g/mol. Its IUPAC name is 1-[2-[3-(4-chlorophenyl)-2-methylpropoxy]butyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[3-(4-chlorophenyl)-2-methylpropoxy]butyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 170360914 |
| Molecular Formula | C18H24ClNO3 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 1-[2-[3-(4-chlorophenyl)-2-methylpropoxy]butyl]pyrrolidine-2,5-dione |
| SMILES | CCC(CN1C(=O)CCC1=O)OCC(C)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H24ClNO3/c1-3-16(11-20-17(21)8-9-18(20)22)23-12-13(2)10-14-4-6-15(19)7-5-14/h4-7,13,16H,3,8-12H2,1-2H3 |
| InChIKey | JXGDAPPKWVIDIT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|