C21H23Cl2NO — CID 91339792
1-[3,4-bis(4-chlorophenyl)butan-2-yl]-5-methylpyrrolidin-2-one (PubChem CID 91339792) has the molecular formula C21H23Cl2NO and a molecular weight of 376.33 g/mol. Its IUPAC name is 1-[3,4-bis(4-chlorophenyl)butan-2-yl]-5-methylpyrrolidin-2-one.
| Compound Name | 1-[3,4-bis(4-chlorophenyl)butan-2-yl]-5-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 91339792 |
| Molecular Formula | C21H23Cl2NO |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 1-[3,4-bis(4-chlorophenyl)butan-2-yl]-5-methylpyrrolidin-2-one |
| SMILES | CC1CCC(=O)N1C(C)C(Cc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H23Cl2NO/c1-14-3-12-21(25)24(14)15(2)20(17-6-10-19(23)11-7-17)13-16-4-8-18(22)9-5-16/h4-11,14-15,20H,3,12-13H2,1-2H3 |
| InChIKey | IAHDXPCDANUHOA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |