C10H8IN3 — CID 170363664
2-cyclopropyl-4-iodopyrido[3,4-d]pyrimidine (PubChem CID 170363664) has the molecular formula C10H8IN3 and a molecular weight of 297.10 g/mol. Its IUPAC name is 2-cyclopropyl-4-iodopyrido[3,4-d]pyrimidine.
| Compound Name | 2-cyclopropyl-4-iodopyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 170363664 |
| Molecular Formula | C10H8IN3 |
| Molecular Weight | 297.10 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 2-cyclopropyl-4-iodopyrido[3,4-d]pyrimidine |
| SMILES | Ic1nc(C2CC2)nc2cnccc12 |
| InChI | InChI=1S/C10H8IN3/c11-9-7-3-4-12-5-8(7)13-10(14-9)6-1-2-6/h3-6H,1-2H2 |
| InChIKey | VKCGERZPHVAEAF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.10 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|