C12H14N4 — CID 516600
3-cyclohexylpyrido[3,4-e][1,2,4]triazine (PubChem CID 516600) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-cyclohexylpyrido[3,4-e][1,2,4]triazine.
| Compound Name | 3-cyclohexylpyrido[3,4-e][1,2,4]triazine |
|---|---|
| PubChem CID | 516600 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 3-cyclohexylpyrido[3,4-e][1,2,4]triazine |
| SMILES | c1cc2nnc(C3CCCCC3)nc2cn1 |
| InChI | InChI=1S/C12H14N4/c1-2-4-9(5-3-1)12-14-11-8-13-7-6-10(11)15-16-12/h6-9H,1-5H2 |
| InChIKey | AJBBGDNWIVFDFK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |