C49H41N3S — CID 170364323
4-[3-[2-ethenyl-6-(4-phenylphenyl)phenyl]-4-methylphenyl]-6-(2-methylsulfanyl-3-phenylphenyl)-2-phenyl-1,2,3,4-tetrahydro-1,3,5-triazine (PubChem CID 170364323) has the molecular formula C49H41N3S and a molecular weight of 703.96 g/mol. Its IUPAC name is 4-[3-[2-ethenyl-6-(4-phenylphenyl)phenyl]-4-methylphenyl]-6-(2-methylsulfanyl-3-phenylphenyl)-2-phenyl-1,2,3,4-tetrahydro-1,3,5-triazine.
| Compound Name | 4-[3-[2-ethenyl-6-(4-phenylphenyl)phenyl]-4-methylphenyl]-6-(2-methylsulfanyl-3-phenylphenyl)-2-phenyl-1,2,3,4-tetrahydro-1,3,5-triazine |
|---|---|
| PubChem CID | 170364323 |
| Molecular Formula | C49H41N3S |
| Molecular Weight | 703.96 g/mol |
| Exact Mass | 703.30 |
| IUPAC Name | 4-[3-[2-ethenyl-6-(4-phenylphenyl)phenyl]-4-methylphenyl]-6-(2-methylsulfanyl-3-phenylphenyl)-2-phenyl-1,2,3,4-tetrahydro-1,3,5-triazine |
| SMILES | C=Cc1cccc(-c2ccc(-c3ccccc3)cc2)c1-c1cc(C2N=C(c3cccc(-c4ccccc4)c3SC)NC(c3ccccc3)N2)ccc1C |
| InChI | InChI=1S/C49H41N3S/c1-4-34-22-14-23-41(38-30-28-36(29-31-38)35-16-8-5-9-17-35)45(34)44-32-40(27-26-33(44)2)48-50-47(39-20-12-7-13-21-39)51-49(52-48)43-25-15-24-42(46(43)53-3)37-18-10-6-11-19-37/h4-32,47-48,50H,1H2,2-3H3,(H,51,52) |
| InChIKey | QAVDWVFPCJALBD-UHFFFAOYSA-N |
| XLogP | 12.36 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.96 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |