C9H18N2O — CID 170366301
1-[(2S,4R)-4-amino-1-propan-2-ylpyrrolidin-2-yl]ethanone (PubChem CID 170366301) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 1-[(2S,4R)-4-amino-1-propan-2-ylpyrrolidin-2-yl]ethanone.
| Compound Name | 1-[(2S,4R)-4-amino-1-propan-2-ylpyrrolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 170366301 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 1-[(2S,4R)-4-amino-1-propan-2-ylpyrrolidin-2-yl]ethanone |
| SMILES | CC(=O)[C@@H]1C[C@@H](N)CN1C(C)C |
| InChI | InChI=1S/C9H18N2O/c1-6(2)11-5-8(10)4-9(11)7(3)12/h6,8-9H,4-5,10H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | WAEUPUCUMXHKRB-BDAKNGLRSA-N |
| XLogP | 0.39 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |