C11H25N3O — CID 141074035
[2-amino-1,3-di(propan-2-yl)-1,3-diazinan-5-yl]methanol (PubChem CID 141074035) has the molecular formula C11H25N3O and a molecular weight of 215.34 g/mol. Its IUPAC name is [2-amino-1,3-di(propan-2-yl)-1,3-diazinan-5-yl]methanol.
| Compound Name | [2-amino-1,3-di(propan-2-yl)-1,3-diazinan-5-yl]methanol |
|---|---|
| PubChem CID | 141074035 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | [2-amino-1,3-di(propan-2-yl)-1,3-diazinan-5-yl]methanol |
| SMILES | CC(C)N1CC(CO)CN(C(C)C)C1N |
| InChI | InChI=1S/C11H25N3O/c1-8(2)13-5-10(7-15)6-14(9(3)4)11(13)12/h8-11,15H,5-7,12H2,1-4H3 |
| InChIKey | LTZAEGXQKOKFGN-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |