About [2-amino-1,3-di(propan-2-yl)-1,3-diazinan-5-yl]methanol
[2-amino-1,3-di(propan-2-yl)-1,3-diazinan-5-yl]methanol (PubChem CID 141074035) has the molecular formula C11H25N3O
and a molecular weight of 215.34 g/mol. Its IUPAC name is [2-amino-1,3-di(propan-2-yl)-1,3-diazinan-5-yl]methanol.
Molecular Properties
| Compound Name | [2-amino-1,3-di(propan-2-yl)-1,3-diazinan-5-yl]methanol |
| PubChem CID | 141074035 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | [2-amino-1,3-di(propan-2-yl)-1,3-diazinan-5-yl]methanol |
| SMILES | CC(C)N1CC(CO)CN(C(C)C)C1N |
| InChI | InChI=1S/C11H25N3O/c1-8(2)13-5-10(7-15)6-14(9(3)4)11(13)12/h8-11,15H,5-7,12H2,1-4H3 |
| InChIKey | LTZAEGXQKOKFGN-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-amino-1,3-di(propan-2-yl)-1,3-diazinan-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-amino-1,3-di(propan-2-yl)-1,3-diazinan-5-yl]methanol?
The IUPAC name of [2-amino-1,3-di(propan-2-yl)-1,3-diazinan-5-yl]methanol (CID 141074035) is [2-amino-1,3-di(propan-2-yl)-1,3-diazinan-5-yl]methanol.
What is the SMILES notation for [2-amino-1,3-di(propan-2-yl)-1,3-diazinan-5-yl]methanol?
The canonical SMILES for [2-amino-1,3-di(propan-2-yl)-1,3-diazinan-5-yl]methanol is CC(C)N1CC(CO)CN(C(C)C)C1N.
What is the InChIKey of [2-amino-1,3-di(propan-2-yl)-1,3-diazinan-5-yl]methanol?
The InChIKey is LTZAEGXQKOKFGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25N3O/c1-8(2)13-5-10(7-15)6-14(9(3)4)11(13)12/h8-11,15H,5-7,12H2,1-4H3.
What are the key properties of [2-amino-1,3-di(propan-2-yl)-1,3-diazinan-5-yl]methanol?
[2-amino-1,3-di(propan-2-yl)-1,3-diazinan-5-yl]methanol has a molecular weight of 215.34 g/mol, XLogP of 0.27, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-amino-1,3-di(propan-2-yl)-1,3-diazinan-5-yl]methanol is sourced from PubChem (CID 141074035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).