C15H25F3N2O3 — CID 170368827
[(3S,8S)-8-(propan-2-yloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-methyl-N-(trifluoromethyl)carbamate (PubChem CID 170368827) has the molecular formula C15H25F3N2O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is [(3S,8S)-8-(propan-2-yloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-methyl-N-(trifluoromethyl)carbamate.
| Compound Name | [(3S,8S)-8-(propan-2-yloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-methyl-N-(trifluoromethyl)carbamate |
|---|---|
| PubChem CID | 170368827 |
| Molecular Formula | C15H25F3N2O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | [(3S,8S)-8-(propan-2-yloxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-methyl-N-(trifluoromethyl)carbamate |
| SMILES | CC(C)OC[C@@]12CCCN1[C@H](COC(=O)N(C)C(F)(F)F)CC2 |
| InChI | InChI=1S/C15H25F3N2O3/c1-11(2)23-10-14-6-4-8-20(14)12(5-7-14)9-22-13(21)19(3)15(16,17)18/h11-12H,4-10H2,1-3H3/t12-,14-/m0/s1 |
| InChIKey | YGYLUTPZSXVMCK-JSGCOSHPSA-N |
| XLogP | 3.00 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|