C21H40N2O3 — CID 175977717
[(3S,8R)-8-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-decyl-N-methylcarbamate (PubChem CID 175977717) has the molecular formula C21H40N2O3 and a molecular weight of 368.56 g/mol. Its IUPAC name is [(3S,8R)-8-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-decyl-N-methylcarbamate.
| Compound Name | [(3S,8R)-8-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-decyl-N-methylcarbamate |
|---|---|
| PubChem CID | 175977717 |
| Molecular Formula | C21H40N2O3 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.30 |
| IUPAC Name | [(3S,8R)-8-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-3-yl]methyl N-decyl-N-methylcarbamate |
| SMILES | CCCCCCCCCCN(C)C(=O)OC[C@@H]1CC[C@@]2(CO)CCCN12 |
| InChI | InChI=1S/C21H40N2O3/c1-3-4-5-6-7-8-9-10-15-22(2)20(25)26-17-19-12-14-21(18-24)13-11-16-23(19)21/h19,24H,3-18H2,1-2H3/t19-,21+/m0/s1 |
| InChIKey | HEKKJIAETMNTTB-PZJWPPBQSA-N |
| XLogP | 4.18 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|