C15H29FN2O3 — CID 177009113
[(3R,8R)-3-(pyrrolidin-1-ylmethoxymethoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol;hydrofluoride (PubChem CID 177009113) has the molecular formula C15H29FN2O3 and a molecular weight of 304.41 g/mol. Its IUPAC name is [(3R,8R)-3-(pyrrolidin-1-ylmethoxymethoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol;hydrofluoride.
| Compound Name | [(3R,8R)-3-(pyrrolidin-1-ylmethoxymethoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol;hydrofluoride |
|---|---|
| PubChem CID | 177009113 |
| Molecular Formula | C15H29FN2O3 |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | [(3R,8R)-3-(pyrrolidin-1-ylmethoxymethoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol;hydrofluoride |
| SMILES | F.OC[C@]12CCCN1[C@@H](COCOCN1CCCC1)CC2 |
| InChI | InChI=1S/C15H28N2O3.FH/c18-11-15-5-3-9-17(15)14(4-6-15)10-19-13-20-12-16-7-1-2-8-16;/h14,18H,1-13H2;1H/t14-,15-;/m1./s1 |
| InChIKey | KZJKEZBGIIVKGC-CTHHTMFSSA-N |
| XLogP | 1.17 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|